Products 57965-22-7
CAS 57965-22-7 appears in our catalog under these names: 4,4,4-Trifluoro-1-(4-hydroxyphenyl)butane-1,3-dione, 95%, 4,4,4-Trifluoro-1-(4-hydroxyphenyl)butane-1,3-dione, 95+%, 4,4,4-Trifluoro-1-(4-hydroxyphenyl)butane-1,3-dione, 4,4,4-Trifluoro-1-(4-hydroxy-phenyl)-butane-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g, 50mg, 500mg.
4,4,4-trifluoro-1-(4-hydroxyphenyl)butane-1,3-dione (CAS 57965-22-7) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: 4,4,4-trifluoro-1-(4-hydroxyphenyl)butane-1,3-dione. InChIKey: XIIXPTDNSYQRHR-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(4-hydroxyphenyl)butane-1,3-dione |
| InChIKey | XIIXPTDNSYQRHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)