Products 2609745-91-5
CAS 2609745-91-5 is the registry number for 6-(1,3-Dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde (CAS 2609745-91-5) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: 6-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde. InChIKey: LJZRBQIGVBVGHE-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | 6-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde |
| InChIKey | LJZRBQIGVBVGHE-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C(=C2C=O)F)F)F |
Computed by PubChem (NCBI)