CAS 62263-12-1 is the registry number for 4-Trifluoroacetylbenzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(2,2,2-trifluoroacetyl)benzoate (CAS 62263-12-1) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: methyl 4-(2,2,2-trifluoroacetyl)benzoate. InChIKey: LRHOYBJCPJPNSG-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | methyl 4-(2,2,2-trifluoroacetyl)benzoate |
| InChIKey | LRHOYBJCPJPNSG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)