Products 62263-12-1

CAS 62263-12-1 is the registry number for 4-Trifluoroacetylbenzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-(2,2,2-trifluoroacetyl)benzoate (CAS 62263-12-1) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: methyl 4-(2,2,2-trifluoroacetyl)benzoate. InChIKey: LRHOYBJCPJPNSG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3O3
Molecular weight232.16 g/mol
IUPAC namemethyl 4-(2,2,2-trifluoroacetyl)benzoate
InChIKeyLRHOYBJCPJPNSG-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C(=O)C(F)(F)F

Computed by PubChem (NCBI)