CAS 1762-46-5 appears in our catalog under these names: Diethyl (2,2'–bipyridine)–5,5'–dicarboxylate, Diethyl [2,2'-Bipyridine]-5,5'-dicarboxylate, >98.0%(GC)(T), Diethyl bipy55'DC 97%, Diethyl [2,2'-bipyridine]-5,5'-dicarboxylate, 96%, 96%, Diethyl bipy55'DC, 98.79%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 200mg, 1g, 100g, 100mg, 250mg, 25g.
Ethyl 6-(5-ethoxycarbonyl-2-pyridinyl)pyridine-3-carboxylate (CAS 1762-46-5) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: ethyl 6-(5-ethoxycarbonyl-2-pyridinyl)pyridine-3-carboxylate. InChIKey: IUNBUYCOAQHBMC-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | ethyl 6-(5-ethoxycarbonyl-2-pyridinyl)pyridine-3-carboxylate |
| InChIKey | IUNBUYCOAQHBMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1)C2=NC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)