CAS 17626-44-7 is the registry number for 2-(Diphenylamino)benzoic acid. Offered by: Biosynth. Available pack sizes: 1000g, 500g.
2-(N-phenylanilino)benzoic acid (CAS 17626-44-7) is a chemical compound with the molecular formula C19H15NO2 and a molecular weight of 289.3 g/mol. IUPAC name: 2-(N-phenylanilino)benzoic acid. InChIKey: ZEGFMCQPAMLDCS-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 2-(N-phenylanilino)benzoic acid |
| InChIKey | ZEGFMCQPAMLDCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)