CAS 188015-78-3 is the registry number for 3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione (CAS 188015-78-3) is a chemical compound with the molecular formula C19H15NO2 and a molecular weight of 289.3 g/mol. IUPAC name: 3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione. InChIKey: DVJZPYLNGFQHRQ-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 3-phenyl-2,3,4,10-tetrahydroacridine-1,9-dione |
| InChIKey | DVJZPYLNGFQHRQ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C2=C1NC3=CC=CC=C3C2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)