CAS 26491-08-7 is the registry number for 4-(1-naphthyl)-4-azatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
4-naphthalen-1-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 26491-08-7) is a chemical compound with the molecular formula C19H15NO2 and a molecular weight of 289.3 g/mol. IUPAC name: 4-naphthalen-1-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: ZQKAEDZRDAKWCT-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 4-naphthalen-1-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | ZQKAEDZRDAKWCT-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)