CAS 333759-52-7 is the registry number for 3-(3-Hydroxyphenyl)-3,4-dihydrobenzo[f]quinolin-1(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-(3-hydroxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one (CAS 333759-52-7) is a chemical compound with the molecular formula C19H15NO2 and a molecular weight of 289.3 g/mol. IUPAC name: 3-(3-hydroxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one. InChIKey: QLTUILRZWVWQLC-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)-3,4-dihydro-2H-benzo[f]quinolin-1-one |
| InChIKey | QLTUILRZWVWQLC-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C(C1=O)C3=CC=CC=C3C=C2)C4=CC(=CC=C4)O |
Computed by PubChem (NCBI)