CAS 6156-37-2 is the registry number for 4-(Diphenylamino)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-(N-phenylanilino)benzoic acid (CAS 6156-37-2) is a chemical compound with the molecular formula C19H15NO2 and a molecular weight of 289.3 g/mol. IUPAC name: 4-(N-phenylanilino)benzoic acid. InChIKey: XUDQSFMBCQRHAX-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2 |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 4-(N-phenylanilino)benzoic acid |
| InChIKey | XUDQSFMBCQRHAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)