Products 17635-19-7

CAS 17635-19-7 is the registry number for 2,3,5-Trimethylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,3,5-trimethylquinoxaline (CAS 17635-19-7) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 2,3,5-trimethylquinoxaline. InChIKey: GGPLGICAGOWZLN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2
Molecular weight172.23 g/mol
IUPAC name2,3,5-trimethylquinoxaline
InChIKeyGGPLGICAGOWZLN-UHFFFAOYSA-N
SMILESCC1=C2C(=CC=C1)N=C(C(=N2)C)C

Computed by PubChem (NCBI)