CAS 17635-19-7 is the registry number for 2,3,5-Trimethylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2,3,5-trimethylquinoxaline (CAS 17635-19-7) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 2,3,5-trimethylquinoxaline. InChIKey: GGPLGICAGOWZLN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 2,3,5-trimethylquinoxaline |
| InChIKey | GGPLGICAGOWZLN-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N=C(C(=N2)C)C |
Computed by PubChem (NCBI)