Products 176433-65-1
CAS 176433-65-1 appears in our catalog under these names: Methyl 6-chloro-5-formylnicotinate, 98%, Methyl 6-chloro-5-formylpyridine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Methyl 6-chloro-5-formylpyridine-3-carboxylate (CAS 176433-65-1) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: methyl 6-chloro-5-formylpyridine-3-carboxylate. InChIKey: HPPCPWQJJUXARS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | methyl 6-chloro-5-formylpyridine-3-carboxylate |
| InChIKey | HPPCPWQJJUXARS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Cl)C=O |
Computed by PubChem (NCBI)