CAS 176684-28-9 is the registry number for 3,3-Dimethyl-1,3-dihydro-2λâ¶,1-benzothiazole-2,2-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,3-dimethyl-1H-2,1-benzothiazole 2,2-dioxide (CAS 176684-28-9) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 3,3-dimethyl-1H-2,1-benzothiazole 2,2-dioxide. InChIKey: VMNDYZPYIJLSNQ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 3,3-dimethyl-1H-2,1-benzothiazole 2,2-dioxide |
| InChIKey | VMNDYZPYIJLSNQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2NS1(=O)=O)C |
Computed by PubChem (NCBI)