Products 177031-12-8

CAS 177031-12-8 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-6-cyanohexanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 177031-12-8) is a chemical compound with the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. IUPAC name: 6-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: CMQMDJLHJZYEPN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N2O4
Molecular weight256.30 g/mol
IUPAC name6-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
InChIKeyCMQMDJLHJZYEPN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCCCC#N)C(=O)O

Computed by PubChem (NCBI)