Products 1771-65-9
CAS 1771-65-9 appears in our catalog under these names: 2-Methyl-4-oxo-4-phenylbutyric acid, 95%, 2-Methyl-4-oxo-4-phenylbutyric Acid, >95% (HPLC), 2-Methyl-4-oxo-4-phenylbutyric acid, 2-Methyl-4-oxo-4-phenylbutanoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
2-methyl-4-oxo-4-phenylbutanoic acid (CAS 1771-65-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2-methyl-4-oxo-4-phenylbutanoic acid. InChIKey: ICXWGAZLLKCSAT-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2-methyl-4-oxo-4-phenylbutanoic acid |
| InChIKey | ICXWGAZLLKCSAT-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Methyl-4-oxo-4-phenylbutanoic acid, 2-Methyl-4-oxo-4-phenylbutyric acid, Benzenebutanoic acid, alpha-methyl-gamma-oxo-, 2-methyl-4-phenyl-4-oxobutanoic acid, alpha-Methyl-gamma-oxobenzenebutanoic acid, 3-benzoyl-2-methylpropionic acid, 2-Methyl-3-benzoylpropionic acid, Propionic acid, 3-benzoyl-2-methyl-, Methylphenacylessigsaure, starbld0016614