CAS 1772152-02-9 is the registry number for Ethyl 3-(4-bromo-3,5-dimethylphenyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(4-bromo-3,5-dimethylphenyl)-1,2,4-oxadiazole-5-carboxylate (CAS 1772152-02-9) is a chemical compound with the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. IUPAC name: ethyl 3-(4-bromo-3,5-dimethylphenyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: ALXGVAZHSIBQJL-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O3 |
|---|---|
| Molecular weight | 325.16 g/mol |
| IUPAC name | ethyl 3-(4-bromo-3,5-dimethylphenyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | ALXGVAZHSIBQJL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CC(=C(C(=C2)C)Br)C |
Computed by PubChem (NCBI)