Products 2828220-44-4
CAS 2828220-44-4 is the registry number for tert-Butyl 6-bromo-4-formyl-1H-indazole-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 6-bromo-4-formylindazole-1-carboxylate (CAS 2828220-44-4) is a chemical compound with the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. IUPAC name: tert-butyl 6-bromo-4-formylindazole-1-carboxylate. InChIKey: MWCWFLFYSLIBQK-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O3 |
|---|---|
| Molecular weight | 325.16 g/mol |
| IUPAC name | tert-butyl 6-bromo-4-formylindazole-1-carboxylate |
| InChIKey | MWCWFLFYSLIBQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC(=CC(=C2C=N1)C=O)Br |
Computed by PubChem (NCBI)