CAS 850893-02-6 is the registry number for 5-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
5-bromo-1-(oxan-2-yl)indazole-3-carboxylic acid (CAS 850893-02-6) is a chemical compound with the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. IUPAC name: 5-bromo-1-(oxan-2-yl)indazole-3-carboxylic acid. InChIKey: TXKAXVLJEMSOMH-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O3 |
|---|---|
| Molecular weight | 325.16 g/mol |
| IUPAC name | 5-bromo-1-(oxan-2-yl)indazole-3-carboxylic acid |
| InChIKey | TXKAXVLJEMSOMH-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=C(C=C(C=C3)Br)C(=N2)C(=O)O |
Computed by PubChem (NCBI)