Products 850893-02-6

CAS 850893-02-6 is the registry number for 5-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

5-bromo-1-(oxan-2-yl)indazole-3-carboxylic acid (CAS 850893-02-6) is a chemical compound with the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. IUPAC name: 5-bromo-1-(oxan-2-yl)indazole-3-carboxylic acid. InChIKey: TXKAXVLJEMSOMH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13BrN2O3
Molecular weight325.16 g/mol
IUPAC name5-bromo-1-(oxan-2-yl)indazole-3-carboxylic acid
InChIKeyTXKAXVLJEMSOMH-UHFFFAOYSA-N
SMILESC1CCOC(C1)N2C3=C(C=C(C=C3)Br)C(=N2)C(=O)O

Computed by PubChem (NCBI)