CAS 2629362-71-4 is the registry number for 5-Bromo-6-methoxy-2-(4-methoxybenzyl)pyridazin-3(2H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-methoxy-2-[(4-methoxyphenyl)methyl]pyridazin-3-one (CAS 2629362-71-4) is a chemical compound with the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. IUPAC name: 5-bromo-6-methoxy-2-[(4-methoxyphenyl)methyl]pyridazin-3-one. InChIKey: NIWDFQAWWGERJP-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O3 |
|---|---|
| Molecular weight | 325.16 g/mol |
| IUPAC name | 5-bromo-6-methoxy-2-[(4-methoxyphenyl)methyl]pyridazin-3-one |
| InChIKey | NIWDFQAWWGERJP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C=C(C(=N2)OC)Br |
Computed by PubChem (NCBI)