Products 252026-08-7

CAS 252026-08-7 is the registry number for 2-Acetamido-3-(4-bromo-1H-indol-3-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-acetamido-3-(4-bromo-1H-indol-3-yl)propanoic acid (CAS 252026-08-7) is a chemical compound with the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. IUPAC name: 2-acetamido-3-(4-bromo-1H-indol-3-yl)propanoic acid. InChIKey: ZHOLTNDTYQGXRY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13BrN2O3
Molecular weight325.16 g/mol
IUPAC name2-acetamido-3-(4-bromo-1H-indol-3-yl)propanoic acid
InChIKeyZHOLTNDTYQGXRY-UHFFFAOYSA-N
SMILESCC(=O)NC(CC1=CNC2=C1C(=CC=C2)Br)C(=O)O

Computed by PubChem (NCBI)