Products 1773497-41-8
CAS 1773497-41-8 appears in our catalog under these names: Phenmedipham D3, Phenmedipham–d3, Phenmedipham-d3. Offered by: Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg.
[3-(trideuteriomethoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate (CAS 1773497-41-8) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 303.33 g/mol. IUPAC name: [3-(trideuteriomethoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate. InChIKey: IDOWTHOLJBTAFI-BMSJAHLVSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 303.33 g/mol |
| IUPAC name | [3-(trideuteriomethoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate |
| InChIKey | IDOWTHOLJBTAFI-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=CC(=CC=C1)OC(=O)NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)