CAS 17745-40-3 appears in our catalog under these names: Methyl 4-propionylbenzoate, 97%, Methyl 4-Propionylbenzoate 95%, Methyl 4-Propionylbenzoate, 95%, 95%, methyl 4-propionylbenzoate. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
Methyl 4-propanoylbenzoate (CAS 17745-40-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: methyl 4-propanoylbenzoate. InChIKey: HJFQWZCJVDZOOO-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | methyl 4-propanoylbenzoate |
| InChIKey | HJFQWZCJVDZOOO-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)