CAS 1777812-71-1 is the registry number for (S)-1-(3,4-Dimethylphenyl)propan-1-amine hydrochloride, 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(1S)-1-(3,4-dimethylphenyl)propan-1-amine;hydrochloride (CAS 1777812-71-1) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-1-(3,4-dimethylphenyl)propan-1-amine;hydrochloride. InChIKey: DHOYDEIOTDWSJT-MERQFXBCSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-1-(3,4-dimethylphenyl)propan-1-amine;hydrochloride |
| InChIKey | DHOYDEIOTDWSJT-MERQFXBCSA-N |
| SMILES | CC[C@@H](C1=CC(=C(C=C1)C)C)N.Cl |
Computed by PubChem (NCBI)