CAS 856563-05-8 is the registry number for (R)-1-(3,4-Dimethylphenyl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(1R)-1-(3,4-dimethylphenyl)propan-1-amine;hydrochloride (CAS 856563-05-8) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-1-(3,4-dimethylphenyl)propan-1-amine;hydrochloride. InChIKey: DHOYDEIOTDWSJT-RFVHGSKJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-1-(3,4-dimethylphenyl)propan-1-amine;hydrochloride |
| InChIKey | DHOYDEIOTDWSJT-RFVHGSKJSA-N |
| SMILES | CC[C@H](C1=CC(=C(C=C1)C)C)N.Cl |
Computed by PubChem (NCBI)