Products 848053-72-5
CAS 848053-72-5 is the registry number for 4-Chloro-3-(methylsulfonyl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-methylsulfonylbenzamide (CAS 848053-72-5) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: 4-chloro-3-methylsulfonylbenzamide. InChIKey: ATVYGJRUEGXTJU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 4-chloro-3-methylsulfonylbenzamide |
| InChIKey | ATVYGJRUEGXTJU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(=O)N)Cl |
Computed by PubChem (NCBI)