CAS 1779944-56-7 appears in our catalog under these names: 2-Methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-Methanesulfonyl-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-methyl-2-methylsulfonyl-1,3-thiazole-5-carboxylic acid (CAS 1779944-56-7) is a chemical compound with the molecular formula C6H7NO4S2 and a molecular weight of 221.3 g/mol. IUPAC name: 4-methyl-2-methylsulfonyl-1,3-thiazole-5-carboxylic acid. InChIKey: HXAPDGVFRHECHL-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 4-methyl-2-methylsulfonyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | HXAPDGVFRHECHL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)