CAS 64527-92-0 appears in our catalog under these names: Tenoxicam Impurity H, 3-((Methylamino)sulfonyl)-2-thiophenecarboxylic Acid, 3-((Methylamino)sulphonyl)thiophene-2-carboxylic Acid, 3-(Methylsulfamoyl)thiophene-2-carboxylic acid. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 100mg, 25mg, 0,05g, 0,025g, 0,1g, 0,25g, 0,5g.
3-(methylsulfamoyl)thiophene-2-carboxylic acid (CAS 64527-92-0) is a chemical compound with the molecular formula C6H7NO4S2 and a molecular weight of 221.3 g/mol. IUPAC name: 3-(methylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: NVUNRWVGRDVKGV-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 3-(methylsulfamoyl)thiophene-2-carboxylic acid |
| InChIKey | NVUNRWVGRDVKGV-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(SC=C1)C(=O)O |
Computed by PubChem (NCBI)