Products 1896052-29-1
CAS 1896052-29-1 is the registry number for 3-((Methylsulfonyl)methyl)isothiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(methylsulfonylmethyl)-1,2-thiazole-5-carboxylic acid (CAS 1896052-29-1) is a chemical compound with the molecular formula C6H7NO4S2 and a molecular weight of 221.3 g/mol. IUPAC name: 3-(methylsulfonylmethyl)-1,2-thiazole-5-carboxylic acid. InChIKey: JLSBYDKBXGXCFR-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 3-(methylsulfonylmethyl)-1,2-thiazole-5-carboxylic acid |
| InChIKey | JLSBYDKBXGXCFR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=NSC(=C1)C(=O)O |
Computed by PubChem (NCBI)