Products 923198-70-3
CAS 923198-70-3 is the registry number for 2-(5-Sulfamoylthiophen-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(5-sulfamoylthiophen-2-yl)acetic acid (CAS 923198-70-3) is a chemical compound with the molecular formula C6H7NO4S2 and a molecular weight of 221.3 g/mol. IUPAC name: 2-(5-sulfamoylthiophen-2-yl)acetic acid. InChIKey: MYYWHMBAXPNBRV-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 2-(5-sulfamoylthiophen-2-yl)acetic acid |
| InChIKey | MYYWHMBAXPNBRV-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)N)CC(=O)O |
Computed by PubChem (NCBI)