CAS 2819434-48-3 is the registry number for Methyl-4-sulfamoylthiophene-3-carboxylate. Offered by: TRC. Available pack sizes: 100mg.
5-methyl-4-sulfamoylthiophene-3-carboxylic acid (CAS 2819434-48-3) is a chemical compound with the molecular formula C6H7NO4S2 and a molecular weight of 221.3 g/mol. IUPAC name: 5-methyl-4-sulfamoylthiophene-3-carboxylic acid. InChIKey: VPXWITYNJWPYDU-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 5-methyl-4-sulfamoylthiophene-3-carboxylic acid |
| InChIKey | VPXWITYNJWPYDU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CS1)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)