Products 1780567-99-8

CAS 1780567-99-8 is the registry number for Methyl 3-fluoropiperidine-4-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-fluoropiperidine-4-carboxylate;hydrochloride (CAS 1780567-99-8) is a chemical compound with the molecular formula C7H13ClFNO2 and a molecular weight of 197.63 g/mol. IUPAC name: methyl 3-fluoropiperidine-4-carboxylate;hydrochloride. InChIKey: IDVRHQMFHIRKGB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClFNO2
Molecular weight197.63 g/mol
IUPAC namemethyl 3-fluoropiperidine-4-carboxylate;hydrochloride
InChIKeyIDVRHQMFHIRKGB-UHFFFAOYSA-N
SMILESCOC(=O)C1CCNCC1F.Cl

Computed by PubChem (NCBI)