Products 2551117-83-8

CAS 2551117-83-8 is the registry number for 3-Fluoro-1-methylpiperidine-3-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

3-fluoro-1-methylpiperidine-3-carboxylic acid;hydrochloride (CAS 2551117-83-8) is a chemical compound with the molecular formula C7H13ClFNO2 and a molecular weight of 197.63 g/mol. IUPAC name: 3-fluoro-1-methylpiperidine-3-carboxylic acid;hydrochloride. InChIKey: FRJWSVYPQMIWKI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClFNO2
Molecular weight197.63 g/mol
IUPAC name3-fluoro-1-methylpiperidine-3-carboxylic acid;hydrochloride
InChIKeyFRJWSVYPQMIWKI-UHFFFAOYSA-N
SMILESCN1CCCC(C1)(C(=O)O)F.Cl

Computed by PubChem (NCBI)