Products 2306254-03-3
CAS 2306254-03-3 is the registry number for Methyl (2S,4R)-4-fluoro-2-methylpyrrolidine-2-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl (2S,4R)-4-fluoro-2-methylpyrrolidine-2-carboxylate;hydrochloride (CAS 2306254-03-3) is a chemical compound with the molecular formula C7H13ClFNO2 and a molecular weight of 197.63 g/mol. IUPAC name: methyl (2S,4R)-4-fluoro-2-methylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: WJSGBBSFASYFES-PACXSXMQSA-N.
| Molecular formula | C7H13ClFNO2 |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | methyl (2S,4R)-4-fluoro-2-methylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | WJSGBBSFASYFES-PACXSXMQSA-N |
| SMILES | C[C@]1(C[C@H](CN1)F)C(=O)OC.Cl |
Computed by PubChem (NCBI)