CAS 2225126-70-3 is the registry number for Methyl 2-((2R,4S)-4-fluoropyrrolidin-2-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetate;hydrochloride (CAS 2225126-70-3) is a chemical compound with the molecular formula C7H13ClFNO2 and a molecular weight of 197.63 g/mol. IUPAC name: methyl 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetate;hydrochloride. InChIKey: PKPRAMFEQDGHCY-GEMLJDPKSA-N.
| Molecular formula | C7H13ClFNO2 |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | methyl 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetate;hydrochloride |
| InChIKey | PKPRAMFEQDGHCY-GEMLJDPKSA-N |
| SMILES | COC(=O)C[C@@H]1C[C@@H](CN1)F.Cl |
Computed by PubChem (NCBI)