Products 2225126-70-3

CAS 2225126-70-3 is the registry number for Methyl 2-((2R,4S)-4-fluoropyrrolidin-2-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetate;hydrochloride (CAS 2225126-70-3) is a chemical compound with the molecular formula C7H13ClFNO2 and a molecular weight of 197.63 g/mol. IUPAC name: methyl 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetate;hydrochloride. InChIKey: PKPRAMFEQDGHCY-GEMLJDPKSA-N.

Identity
Molecular formulaC7H13ClFNO2
Molecular weight197.63 g/mol
IUPAC namemethyl 2-[(2R,4S)-4-fluoropyrrolidin-2-yl]acetate;hydrochloride
InChIKeyPKPRAMFEQDGHCY-GEMLJDPKSA-N
SMILESCOC(=O)C[C@@H]1C[C@@H](CN1)F.Cl

Computed by PubChem (NCBI)