CAS 2901043-18-1 is the registry number for Ethyl (2R,4S)-4-fluoropyrrolidine-2-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,4S)-4-fluoropyrrolidine-2-carboxylate;hydrochloride (CAS 2901043-18-1) is a chemical compound with the molecular formula C7H13ClFNO2 and a molecular weight of 197.63 g/mol. IUPAC name: ethyl (2R,4S)-4-fluoropyrrolidine-2-carboxylate;hydrochloride. InChIKey: UASGLVUKQFPIDT-RIHPBJNCSA-N.
| Molecular formula | C7H13ClFNO2 |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | ethyl (2R,4S)-4-fluoropyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | UASGLVUKQFPIDT-RIHPBJNCSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H](CN1)F.Cl |
Computed by PubChem (NCBI)