Products 1781492-78-1
CAS 1781492-78-1 is the registry number for 7-Bromo-5-methoxyindole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g.
7-bromo-5-methoxy-1H-indole-3-carboxylic acid (CAS 1781492-78-1) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 7-bromo-5-methoxy-1H-indole-3-carboxylic acid. InChIKey: JMRSCOAPBJNXGR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 7-bromo-5-methoxy-1H-indole-3-carboxylic acid |
| InChIKey | JMRSCOAPBJNXGR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)Br)NC=C2C(=O)O |
Computed by PubChem (NCBI)