CAS 1781644-15-2 appears in our catalog under these names: 3-Cyclobutylpicolinic acid, 95%, 3-Cyclobutylpicolinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
3-cyclobutylpyridine-2-carboxylic acid (CAS 1781644-15-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 3-cyclobutylpyridine-2-carboxylic acid. InChIKey: ZPHFRUWLRBGPGI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 3-cyclobutylpyridine-2-carboxylic acid |
| InChIKey | ZPHFRUWLRBGPGI-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=C(N=CC=C2)C(=O)O |
Computed by PubChem (NCBI)