CAS 1781798-08-0 is the registry number for 6-Methyl-5,6,7,8-tetrahydroquinoline-2-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-methyl-5,6,7,8-tetrahydroquinoline-2-carbonitrile (CAS 1781798-08-0) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 6-methyl-5,6,7,8-tetrahydroquinoline-2-carbonitrile. InChIKey: RIPKZSCHFQWKQI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 6-methyl-5,6,7,8-tetrahydroquinoline-2-carbonitrile |
| InChIKey | RIPKZSCHFQWKQI-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C=CC(=N2)C#N |
Computed by PubChem (NCBI)