Products 1781942-72-0
CAS 1781942-72-0 is the registry number for 7-Bromo-1-isobutyl-1H-pyrrolo[3,2-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine (CAS 1781942-72-0) is a chemical compound with the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. IUPAC name: 7-bromo-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine. InChIKey: DTGCUSUBLGHOPM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2 |
|---|---|
| Molecular weight | 253.14 g/mol |
| IUPAC name | 7-bromo-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine |
| InChIKey | DTGCUSUBLGHOPM-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=CC2=NC=CC(=C21)Br |
Computed by PubChem (NCBI)