Products 1782450-68-3
CAS 1782450-68-3 is the registry number for 4-Methoxy-1-methyl-1H-pyrazolo(3,4-d)pyrimidin-6-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-methoxy-1-methylpyrazolo[5,4-d]pyrimidin-6-amine (CAS 1782450-68-3) is a chemical compound with the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. IUPAC name: 4-methoxy-1-methylpyrazolo[5,4-d]pyrimidin-6-amine. InChIKey: SDXCYAUYEUOJQT-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 4-methoxy-1-methylpyrazolo[5,4-d]pyrimidin-6-amine |
| InChIKey | SDXCYAUYEUOJQT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=NC(=N2)N)OC |
Computed by PubChem (NCBI)