Products 1782770-61-9
CAS 1782770-61-9 appears in our catalog under these names: 7-Bromo-3,4-dihydro-2h-benzo[b][1,4]oxazine-2-carboxylic acid, 95%, 7-Bromo-3,4-dihydro-2H-benzo(b)(1,4)oxazine-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7-bromo-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid (CAS 1782770-61-9) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid. InChIKey: IYIWTEQSTLVPSJ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | IYIWTEQSTLVPSJ-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(N1)C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)