CAS 178313-45-6 is the registry number for 4-Bromo-N-methoxy-N,2-dimethylbenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
4-bromo-N-methoxy-N,2-dimethylbenzamide (CAS 178313-45-6) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 4-bromo-N-methoxy-N,2-dimethylbenzamide. InChIKey: MUTHMRPWEAXRML-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 4-bromo-N-methoxy-N,2-dimethylbenzamide |
| InChIKey | MUTHMRPWEAXRML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)N(C)OC |
Computed by PubChem (NCBI)