Products 1783405-27-5
CAS 1783405-27-5 is the registry number for methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (CAS 1783405-27-5) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate. InChIKey: NBBDSKLWKLHOAO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| InChIKey | NBBDSKLWKLHOAO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=CN=C(C=C12)Cl |
Computed by PubChem (NCBI)