CAS 1783559-46-5 is the registry number for 6-Bromo-4-ethoxy-2,3-difluorophenol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
6-bromo-4-ethoxy-2,3-difluorophenol (CAS 1783559-46-5) is a chemical compound with the molecular formula C8H7BrF2O2 and a molecular weight of 253.04 g/mol. IUPAC name: 6-bromo-4-ethoxy-2,3-difluorophenol. InChIKey: KMQYXKVHTVMKNN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O2 |
|---|---|
| Molecular weight | 253.04 g/mol |
| IUPAC name | 6-bromo-4-ethoxy-2,3-difluorophenol |
| InChIKey | KMQYXKVHTVMKNN-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1F)F)O)Br |
Computed by PubChem (NCBI)