CAS 1783698-38-3 is the registry number for Efavirenz Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanol (CAS 1783698-38-3) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: IIOWADMQIPAFSW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | IIOWADMQIPAFSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(C(F)(F)F)O)N |
Computed by PubChem (NCBI)