Products 1783954-69-7
CAS 1783954-69-7 appears in our catalog under these names: 5-Bromo-1-methyl-7-(trifluoromethyl)-1H-indazole, 95%, 95%, 5-Bromo-1-methyl-7-(trifluoromethyl)-1H-indazole 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-methyl-7-(trifluoromethyl)indazole (CAS 1783954-69-7) is a chemical compound with the molecular formula C9H6BrF3N2 and a molecular weight of 279.06 g/mol. IUPAC name: 5-bromo-1-methyl-7-(trifluoromethyl)indazole. InChIKey: XSPQGIWNKUKPIO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 5-bromo-1-methyl-7-(trifluoromethyl)indazole |
| InChIKey | XSPQGIWNKUKPIO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2C(F)(F)F)Br)C=N1 |
Computed by PubChem (NCBI)