Products 36443-79-5
CAS 36443-79-5 is the registry number for 1H-Imidazolium, 1,2-dimethyl-3-(phenylmethyl)-, chloride (1:1), 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g.
1-benzyl-2,3-dimethylimidazol-3-ium chloride (CAS 36443-79-5) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 1-benzyl-2,3-dimethylimidazol-3-ium chloride. InChIKey: RFKFOECQRDXIEL-UHFFFAOYSA-M.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 1-benzyl-2,3-dimethylimidazol-3-ium chloride |
| InChIKey | RFKFOECQRDXIEL-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C=CN1CC2=CC=CC=C2)C.[Cl-] |
Computed by PubChem (NCBI)