CAS 178424-17-4 appears in our catalog under these names: 1-tert-Butyl 4-ethyl 3-hydroxy-1H-pyrazole-1,4-dicarboxylate, 1-Tert-Butyl 4-Ethyl 3-Hydroxy-1H-Pyrazole-1,4-Dicarboxylate, 98%, 98%, 1-tert-butyl 4-ethyl 3-oxo-2,3-dihydro-1H-pyrazole-1,4-dicarboxylate, 98%, 1-(tert-Butyl) 4-ethyl 3-oxo-2,3-dihydro-1H-pyrazole-1,4-dicarboxylate, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 2,5g, 5g, 10g, 100g, 250g.
2-O-tert-butyl 4-O-ethyl 5-oxo-1H-pyrazole-2,4-dicarboxylate (CAS 178424-17-4) is a chemical compound with the molecular formula C11H16N2O5 and a molecular weight of 256.25 g/mol. IUPAC name: 2-O-tert-butyl 4-O-ethyl 5-oxo-1H-pyrazole-2,4-dicarboxylate. InChIKey: VAASDFPRJZEMMO-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-O-tert-butyl 4-O-ethyl 5-oxo-1H-pyrazole-2,4-dicarboxylate |
| InChIKey | VAASDFPRJZEMMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(NC1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)