Products 178429-62-4
CAS 178429-62-4 appears in our catalog under these names: Solriamfetol, Solriamfetol, >95% (HPLC), (2R)-2-Amino-3-phenylpropyl carbamate, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 500mg, 50mg, 10mg, 10mM (in 1ml dmso), 25mg, 1g, 0,5g.
[(2R)-2-amino-3-phenylpropyl] carbamate (CAS 178429-62-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: [(2R)-2-amino-3-phenylpropyl] carbamate. InChIKey: UCTRAOBQFUDCSR-SECBINFHSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | [(2R)-2-amino-3-phenylpropyl] carbamate |
| InChIKey | UCTRAOBQFUDCSR-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](COC(=O)N)N |
Computed by PubChem (NCBI)
Synonyms:
Solriamfetol, (2R)-2-amino-3-phenylpropyl carbamate, [(2R)-2-amino-3-phenylpropyl] carbamate, Benzenepropanol, beta-amino-, carbamate (ester), (R)-, Benzenepropanol, beta-amino-, carbamate (ester), (betaR)-, ((2R)-2-amino-3-phenylpropyl) carbamate, solriamfetolum, Sunosi, (R)-2-amino-3-phenylpropyl carbamate, Solriamfetol [USAN]