CAS 178429-63-5 is the registry number for (S)-Solriamfetol . Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-2-amino-3-phenylpropyl] carbamate (CAS 178429-63-5) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: [(2S)-2-amino-3-phenylpropyl] carbamate. InChIKey: UCTRAOBQFUDCSR-VIFPVBQESA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | [(2S)-2-amino-3-phenylpropyl] carbamate |
| InChIKey | UCTRAOBQFUDCSR-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](COC(=O)N)N |
Computed by PubChem (NCBI)