Products 178429-65-7
CAS 178429-65-7 appears in our catalog under these names: Solriamfetol hydrochloride, (βR)-β-amino-Benzenepropanol 1-carbamate hydrochloride, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g, 5g.
[(2R)-2-amino-3-phenylpropyl] carbamate;hydrochloride (CAS 178429-65-7) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: [(2R)-2-amino-3-phenylpropyl] carbamate;hydrochloride. InChIKey: KAOVAAHCFNYXNJ-SBSPUUFOSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | [(2R)-2-amino-3-phenylpropyl] carbamate;hydrochloride |
| InChIKey | KAOVAAHCFNYXNJ-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](COC(=O)N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Solriamfetol hydrochloride, Solriamfetol HCl, Solriamfetol (hydrochloride), Solriamfetol hydrochloride [USAN], [(2R)-2-amino-3-phenylpropyl] carbamate;hydrochloride, Solriamfetol hydrochloride (USAN), (betaR)-beta-amino-Benzenepropanol 1-carbamate hydrochloride, Sunosi (TN), Solriamfetol hydrochloride?, orb573149